C4H4F6O2S — CID 141059223
1,1,4,4,4-pentafluorobutane-1-sulfonyl fluoride (PubChem CID 141059223) has the molecular formula C4H4F6O2S and a molecular weight of 230.13 g/mol. Its IUPAC name is 1,1,4,4,4-pentafluorobutane-1-sulfonyl fluoride.
| Compound Name | 1,1,4,4,4-pentafluorobutane-1-sulfonyl fluoride |
|---|---|
| PubChem CID | 141059223 |
| Molecular Formula | C4H4F6O2S |
| Molecular Weight | 230.13 g/mol |
| Exact Mass | 229.98 |
| IUPAC Name | 1,1,4,4,4-pentafluorobutane-1-sulfonyl fluoride |
| SMILES | O=S(=O)(F)C(F)(F)CCC(F)(F)F |
| InChI | InChI=1S/C4H4F6O2S/c5-3(6,7)1-2-4(8,9)13(10,11)12/h1-2H2 |
| InChIKey | KJPKHRMPASOCGL-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.13 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |