C5H8F7NO3S — CID 141492025
azanium 1,1,2,2,5,5,5-heptafluoropentane-1-sulfonate (PubChem CID 141492025) has the molecular formula C5H8F7NO3S and a molecular weight of 295.18 g/mol. Its IUPAC name is azanium 1,1,2,2,5,5,5-heptafluoropentane-1-sulfonate.
| Compound Name | azanium 1,1,2,2,5,5,5-heptafluoropentane-1-sulfonate |
|---|---|
| PubChem CID | 141492025 |
| Molecular Formula | C5H8F7NO3S |
| Molecular Weight | 295.18 g/mol |
| Exact Mass | 295.01 |
| IUPAC Name | azanium 1,1,2,2,5,5,5-heptafluoropentane-1-sulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)(F)CCC(F)(F)F.[NH4+] |
| InChI | InChI=1S/C5H5F7O3S.H3N/c6-3(7,1-2-4(8,9)10)5(11,12)16(13,14)15;/h1-2H2,(H,13,14,15);1H3 |
| InChIKey | VMMJRLNPORKHOL-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.18 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|