C5H7F4O4S- — CID 58036986
1,1,2,2-tetrafluoro-5-hydroxypentane-1-sulfonate (PubChem CID 58036986) has the molecular formula C5H7F4O4S- and a molecular weight of 239.17 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-5-hydroxypentane-1-sulfonate.
| Compound Name | 1,1,2,2-tetrafluoro-5-hydroxypentane-1-sulfonate |
|---|---|
| PubChem CID | 58036986 |
| Molecular Formula | C5H7F4O4S- |
| Molecular Weight | 239.17 g/mol |
| Exact Mass | 239.00 |
| IUPAC Name | 1,1,2,2-tetrafluoro-5-hydroxypentane-1-sulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)(F)CCCO |
| InChI | InChI=1S/C5H8F4O4S/c6-4(7,2-1-3-10)5(8,9)14(11,12)13/h10H,1-3H2,(H,11,12,13)/p-1 |
| InChIKey | YIAOJXDXNNDCSF-UHFFFAOYSA-M |
| XLogP | 0.53 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.17 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|