C7H12F4O3S — CID 88941942
5,5,6,6-tetrafluoro-6-methylsulfonylhexan-1-ol (PubChem CID 88941942) has the molecular formula C7H12F4O3S and a molecular weight of 252.23 g/mol. Its IUPAC name is 5,5,6,6-tetrafluoro-6-methylsulfonylhexan-1-ol.
| Compound Name | 5,5,6,6-tetrafluoro-6-methylsulfonylhexan-1-ol |
|---|---|
| PubChem CID | 88941942 |
| Molecular Formula | C7H12F4O3S |
| Molecular Weight | 252.23 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | 5,5,6,6-tetrafluoro-6-methylsulfonylhexan-1-ol |
| SMILES | CS(=O)(=O)C(F)(F)C(F)(F)CCCCO |
| InChI | InChI=1S/C7H12F4O3S/c1-15(13,14)7(10,11)6(8,9)4-2-3-5-12/h12H,2-5H2,1H3 |
| InChIKey | BLXOVYILRSMXOS-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.23 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|