C16H26F8O — CID 121403306
10,10,11,11,12,12,13,13-octafluorohexadecan-1-ol (PubChem CID 121403306) has the molecular formula C16H26F8O and a molecular weight of 386.37 g/mol. Its IUPAC name is 10,10,11,11,12,12,13,13-octafluorohexadecan-1-ol.
| Compound Name | 10,10,11,11,12,12,13,13-octafluorohexadecan-1-ol |
|---|---|
| PubChem CID | 121403306 |
| Molecular Formula | C16H26F8O |
| Molecular Weight | 386.37 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 10,10,11,11,12,12,13,13-octafluorohexadecan-1-ol |
| SMILES | CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)CCCCCCCCCO |
| InChI | InChI=1S/C16H26F8O/c1-2-10-13(17,18)15(21,22)16(23,24)14(19,20)11-8-6-4-3-5-7-9-12-25/h25H,2-12H2,1H3 |
| InChIKey | OSEHDLYJCMLPHW-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.37 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|