C15H20F12O2 — CID 121403333
4,4,5,5,6,6,7,7,8,8,9,9-dodecafluoro-10-pentoxydecan-1-ol (PubChem CID 121403333) has the molecular formula C15H20F12O2 and a molecular weight of 460.30 g/mol. Its IUPAC name is 4,4,5,5,6,6,7,7,8,8,9,9-dodecafluoro-10-pentoxydecan-1-ol.
| Compound Name | 4,4,5,5,6,6,7,7,8,8,9,9-dodecafluoro-10-pentoxydecan-1-ol |
|---|---|
| PubChem CID | 121403333 |
| Molecular Formula | C15H20F12O2 |
| Molecular Weight | 460.30 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | 4,4,5,5,6,6,7,7,8,8,9,9-dodecafluoro-10-pentoxydecan-1-ol |
| SMILES | CCCCCOCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCCO |
| InChI | InChI=1S/C15H20F12O2/c1-2-3-4-8-29-9-11(18,19)13(22,23)15(26,27)14(24,25)12(20,21)10(16,17)6-5-7-28/h28H,2-9H2,1H3 |
| InChIKey | SFHTVWPNTCFLOF-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.30 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|