C19H28F12O3 — CID 121403378
4-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoro-8-heptoxyoctoxy)butan-1-ol (PubChem CID 121403378) has the molecular formula C19H28F12O3 and a molecular weight of 532.41 g/mol. Its IUPAC name is 4-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoro-8-heptoxyoctoxy)butan-1-ol.
| Compound Name | 4-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoro-8-heptoxyoctoxy)butan-1-ol |
|---|---|
| PubChem CID | 121403378 |
| Molecular Formula | C19H28F12O3 |
| Molecular Weight | 532.41 g/mol |
| Exact Mass | 532.18 |
| IUPAC Name | 4-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoro-8-heptoxyoctoxy)butan-1-ol |
| SMILES | CCCCCCCOCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)COCCCCO |
| InChI | InChI=1S/C19H28F12O3/c1-2-3-4-5-7-10-33-12-14(20,21)16(24,25)18(28,29)19(30,31)17(26,27)15(22,23)13-34-11-8-6-9-32/h32H,2-13H2,1H3 |
| InChIKey | XQHPOEQJMYJNCV-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.41 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|