C15H24F8O2 — CID 121403285
4,4,5,5,6,6,7,7-octafluoro-7-octoxyheptan-1-ol (PubChem CID 121403285) has the molecular formula C15H24F8O2 and a molecular weight of 388.34 g/mol. Its IUPAC name is 4,4,5,5,6,6,7,7-octafluoro-7-octoxyheptan-1-ol.
| Compound Name | 4,4,5,5,6,6,7,7-octafluoro-7-octoxyheptan-1-ol |
|---|---|
| PubChem CID | 121403285 |
| Molecular Formula | C15H24F8O2 |
| Molecular Weight | 388.34 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 4,4,5,5,6,6,7,7-octafluoro-7-octoxyheptan-1-ol |
| SMILES | CCCCCCCCOC(F)(F)C(F)(F)C(F)(F)C(F)(F)CCCO |
| InChI | InChI=1S/C15H24F8O2/c1-2-3-4-5-6-7-11-25-15(22,23)14(20,21)13(18,19)12(16,17)9-8-10-24/h24H,2-11H2,1H3 |
| InChIKey | ZQDWZHRENNSXAK-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.34 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|