C8H18F3NO — CID 87553441
triethylazanium;2,2,2-trifluoroethanolate (PubChem CID 87553441) has the molecular formula C8H18F3NO and a molecular weight of 201.23 g/mol. Its IUPAC name is triethylazanium;2,2,2-trifluoroethanolate.
| Compound Name | triethylazanium;2,2,2-trifluoroethanolate |
|---|---|
| PubChem CID | 87553441 |
| Molecular Formula | C8H18F3NO |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | triethylazanium;2,2,2-trifluoroethanolate |
| SMILES | CC[NH+](CC)CC.[O-]CC(F)(F)F |
| InChI | InChI=1S/C6H15N.C2H2F3O/c1-4-7(5-2)6-3;3-2(4,5)1-6/h4-6H2,1-3H3;1H2/q;-1/p+1 |
| InChIKey | XYIAEIJXZRDJGE-UHFFFAOYSA-O |
| XLogP | -0.16 |
| TPSA | 27.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |