About Triethylammonium borohydride
Triethylammonium borohydride (PubChem CID 6365648) has the molecular formula C6H16BN
and a molecular weight of 113.01 g/mol.
Molecular Properties
| Compound Name | Triethylammonium borohydride |
| PubChem CID | 6365648 |
| Molecular Formula | C6H16BN |
| Molecular Weight | 113.01 g/mol |
| Exact Mass | 113.14 |
| IUPAC Name | — |
| SMILES | CC[NH+](CC)CC.[B-] |
| InChI | InChI=1S/C6H15N.B/c1-4-7(5-2)6-3;/h4-6H2,1-3H3;/q;-1/p+1 |
| InChIKey | UZJAGABQYXJREF-UHFFFAOYSA-O |
| XLogP | -0.45 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.01 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Triethylammonium borohydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Triethylammonium borohydride?
The IUPAC name of Triethylammonium borohydride (CID 6365648) is not available.
What is the SMILES notation for Triethylammonium borohydride?
The canonical SMILES for Triethylammonium borohydride is CC[NH+](CC)CC.[B-].
What is the InChIKey of Triethylammonium borohydride?
The InChIKey is UZJAGABQYXJREF-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H15N.B/c1-4-7(5-2)6-3;/h4-6H2,1-3H3;/q;-1/p+1.
What are the key properties of Triethylammonium borohydride?
Triethylammonium borohydride has a molecular weight of 113.01 g/mol, XLogP of -0.45, 3 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Triethylammonium borohydride is sourced from PubChem (CID 6365648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).