About triethylazanium;1,2,5-trimethylpyrrole
triethylazanium;1,2,5-trimethylpyrrole (PubChem CID 90891861) has the molecular formula C13H27N2+
and a molecular weight of 211.37 g/mol. Its IUPAC name is triethylazanium;1,2,5-trimethylpyrrole.
Molecular Properties
| Compound Name | triethylazanium;1,2,5-trimethylpyrrole |
| PubChem CID | 90891861 |
| Molecular Formula | C13H27N2+ |
| Molecular Weight | 211.37 g/mol |
| Exact Mass | 211.22 |
| IUPAC Name | triethylazanium;1,2,5-trimethylpyrrole |
| SMILES | CC[NH+](CC)CC.Cc1ccc(C)n1C |
| InChI | InChI=1S/C7H11N.C6H15N/c1-6-4-5-7(2)8(6)3;1-4-7(5-2)6-3/h4-5H,1-3H3;4-6H2,1-3H3/p+1 |
| InChIKey | XMKWBIYMGHVBDV-UHFFFAOYSA-O |
| XLogP | 1.57 |
| TPSA | 9.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.37 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze triethylazanium;1,2,5-trimethylpyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethylazanium;1,2,5-trimethylpyrrole?
The IUPAC name of triethylazanium;1,2,5-trimethylpyrrole (CID 90891861) is triethylazanium;1,2,5-trimethylpyrrole.
What is the SMILES notation for triethylazanium;1,2,5-trimethylpyrrole?
The canonical SMILES for triethylazanium;1,2,5-trimethylpyrrole is CC[NH+](CC)CC.Cc1ccc(C)n1C.
What is the InChIKey of triethylazanium;1,2,5-trimethylpyrrole?
The InChIKey is XMKWBIYMGHVBDV-UHFFFAOYSA-O. The full InChI is InChI=1S/C7H11N.C6H15N/c1-6-4-5-7(2)8(6)3;1-4-7(5-2)6-3/h4-5H,1-3H3;4-6H2,1-3H3/p+1.
What are the key properties of triethylazanium;1,2,5-trimethylpyrrole?
triethylazanium;1,2,5-trimethylpyrrole has a molecular weight of 211.37 g/mol, XLogP of 1.57, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for triethylazanium;1,2,5-trimethylpyrrole is sourced from PubChem (CID 90891861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).