C17H26N3+ — CID 7315801
(4,10-dimethyl-6,9-diazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraen-5-yl)methyl-diethylazanium (PubChem CID 7315801) has the molecular formula C17H26N3+ and a molecular weight of 272.42 g/mol. Its IUPAC name is (4,10-dimethyl-6,9-diazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraen-5-yl)methyl-diethylazanium.
| Compound Name | (4,10-dimethyl-6,9-diazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraen-5-yl)methyl-diethylazanium |
|---|---|
| PubChem CID | 7315801 |
| Molecular Formula | C17H26N3+ |
| Molecular Weight | 272.42 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | (4,10-dimethyl-6,9-diazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraen-5-yl)methyl-diethylazanium |
| SMILES | CC[NH+](CC)Cc1c(C)cc2n1CCn1c(C)ccc1-2 |
| InChI | InChI=1S/C17H25N3/c1-5-18(6-2)12-17-13(3)11-16-15-8-7-14(4)19(15)9-10-20(16)17/h7-8,11H,5-6,9-10,12H2,1-4H3/p+1 |
| InChIKey | DJRLQKANSFRKAX-UHFFFAOYSA-O |
| XLogP | 2.01 |
| TPSA | 14.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.42 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_C(8)', 'substructure': 'N/A'} |
|---|