C10H17N — CID 7036282
1-[(2S)-butan-2-yl]-2,5-dimethylpyrrole (PubChem CID 7036282) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is 1-[(2S)-butan-2-yl]-2,5-dimethylpyrrole.
| Compound Name | 1-[(2S)-butan-2-yl]-2,5-dimethylpyrrole |
|---|---|
| PubChem CID | 7036282 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 1-[(2S)-butan-2-yl]-2,5-dimethylpyrrole |
| SMILES | CC[C@H](C)n1c(C)ccc1C |
| InChI | InChI=1S/C10H17N/c1-5-8(2)11-9(3)6-7-10(11)4/h6-8H,5H2,1-4H3/t8-/m0/s1 |
| InChIKey | OCHWMCOTLFBHFS-QMMMGPOBSA-N |
| XLogP | 3.08 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |