C13H17NS — CID 60723209
2,5-dimethyl-1-(1-thiophen-2-ylpropan-2-yl)pyrrole (PubChem CID 60723209) has the molecular formula C13H17NS and a molecular weight of 219.35 g/mol. Its IUPAC name is 2,5-dimethyl-1-(1-thiophen-2-ylpropan-2-yl)pyrrole.
| Compound Name | 2,5-dimethyl-1-(1-thiophen-2-ylpropan-2-yl)pyrrole |
|---|---|
| PubChem CID | 60723209 |
| Molecular Formula | C13H17NS |
| Molecular Weight | 219.35 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 2,5-dimethyl-1-(1-thiophen-2-ylpropan-2-yl)pyrrole |
| SMILES | Cc1ccc(C)n1C(C)Cc1cccs1 |
| InChI | InChI=1S/C13H17NS/c1-10-6-7-11(2)14(10)12(3)9-13-5-4-8-15-13/h4-8,12H,9H2,1-3H3 |
| InChIKey | WNEIQGZOBUXCKO-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.35 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |