C14H14FN3S — CID 63292479
4-fluoro-1-(1-thiophen-2-ylpropan-2-yl)benzimidazol-2-amine (PubChem CID 63292479) has the molecular formula C14H14FN3S and a molecular weight of 275.35 g/mol. Its IUPAC name is 4-fluoro-1-(1-thiophen-2-ylpropan-2-yl)benzimidazol-2-amine.
| Compound Name | 4-fluoro-1-(1-thiophen-2-ylpropan-2-yl)benzimidazol-2-amine |
|---|---|
| PubChem CID | 63292479 |
| Molecular Formula | C14H14FN3S |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 4-fluoro-1-(1-thiophen-2-ylpropan-2-yl)benzimidazol-2-amine |
| SMILES | CC(Cc1cccs1)n1c(N)nc2c(F)cccc21 |
| InChI | InChI=1S/C14H14FN3S/c1-9(8-10-4-3-7-19-10)18-12-6-2-5-11(15)13(12)17-14(18)16/h2-7,9H,8H2,1H3,(H2,16,17) |
| InChIKey | AKDANOIOZOEDHP-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |