C13H23N — CID 63404385
1-heptan-2-yl-2,5-dimethylpyrrole (PubChem CID 63404385) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is 1-heptan-2-yl-2,5-dimethylpyrrole.
| Compound Name | 1-heptan-2-yl-2,5-dimethylpyrrole |
|---|---|
| PubChem CID | 63404385 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | 1-heptan-2-yl-2,5-dimethylpyrrole |
| SMILES | CCCCCC(C)n1c(C)ccc1C |
| InChI | InChI=1S/C13H23N/c1-5-6-7-8-11(2)14-12(3)9-10-13(14)4/h9-11H,5-8H2,1-4H3 |
| InChIKey | ANUNXDOLIMMZPH-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|