C11H20ClN3 — CID 63385652
3-chloro-5-methyl-4-octan-2-yl-1,2,4-triazole (PubChem CID 63385652) has the molecular formula C11H20ClN3 and a molecular weight of 229.75 g/mol. Its IUPAC name is 3-chloro-5-methyl-4-octan-2-yl-1,2,4-triazole.
| Compound Name | 3-chloro-5-methyl-4-octan-2-yl-1,2,4-triazole |
|---|---|
| PubChem CID | 63385652 |
| Molecular Formula | C11H20ClN3 |
| Molecular Weight | 229.75 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | 3-chloro-5-methyl-4-octan-2-yl-1,2,4-triazole |
| SMILES | CCCCCCC(C)n1c(C)nnc1Cl |
| InChI | InChI=1S/C11H20ClN3/c1-4-5-6-7-8-9(2)15-10(3)13-14-11(15)12/h9H,4-8H2,1-3H3 |
| InChIKey | HJYLCXAINAGVHQ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.75 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|