2-(4,6-dimethyl-1-octan-2-yl-2-oxopyrimidin-5-yl)acetic acid

C16H26N2O3 — CID 61478439

IUPAC2-(4,6-dimethyl-1-octan-2-yl-2-oxopyrimidin-5-yl)acetic acid
SMILESCCCCCCC(C)n1c(C)c(CC(=O)O)c(C)nc1=O
InChIInChI=1S/C16H26N2O3/c1-5-6-7-8-9-11(2)18-13(4)14(10-15(19)20)12(3)17-16(18)21/h11H,5-10H2,1-4H3,(H,19,20)
InChIKeyJDMMXOUNOVILAG-UHFFFAOYSA-N
MW294.39 g/mol
LogP3.02
Rot. Bonds8

About 2-(4,6-dimethyl-1-octan-2-yl-2-oxopyrimidin-5-yl)acetic acid

2-(4,6-dimethyl-1-octan-2-yl-2-oxopyrimidin-5-yl)acetic acid (PubChem CID 61478439) has the molecular formula C16H26N2O3 and a molecular weight of 294.39 g/mol. Its IUPAC name is 2-(4,6-dimethyl-1-octan-2-yl-2-oxopyrimidin-5-yl)acetic acid.

Molecular Properties

Compound Name2-(4,6-dimethyl-1-octan-2-yl-2-oxopyrimidin-5-yl)acetic acid
PubChem CID61478439
Molecular FormulaC16H26N2O3
Molecular Weight294.39 g/mol
Exact Mass294.19
IUPAC Name2-(4,6-dimethyl-1-octan-2-yl-2-oxopyrimidin-5-yl)acetic acid
SMILESCCCCCCC(C)n1c(C)c(CC(=O)O)c(C)nc1=O
InChIInChI=1S/C16H26N2O3/c1-5-6-7-8-9-11(2)18-13(4)14(10-15(19)20)12(3)17-16(18)21/h11H,5-10H2,1-4H3,(H,19,20)
InChIKeyJDMMXOUNOVILAG-UHFFFAOYSA-N
XLogP3.02
TPSA72.19 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds8
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500294.39
LogP ≤ 53.02
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-(4,6-dimethyl-1-octan-2-yl-2-oxopyrimidin-5-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4,6-dimethyl-1-octan-2-yl-2-oxopyrimidin-5-yl)acetic acid?
The IUPAC name of 2-(4,6-dimethyl-1-octan-2-yl-2-oxopyrimidin-5-yl)acetic acid (CID 61478439) is 2-(4,6-dimethyl-1-octan-2-yl-2-oxopyrimidin-5-yl)acetic acid.
What is the SMILES notation for 2-(4,6-dimethyl-1-octan-2-yl-2-oxopyrimidin-5-yl)acetic acid?
The canonical SMILES for 2-(4,6-dimethyl-1-octan-2-yl-2-oxopyrimidin-5-yl)acetic acid is CCCCCCC(C)n1c(C)c(CC(=O)O)c(C)nc1=O.
What is the InChIKey of 2-(4,6-dimethyl-1-octan-2-yl-2-oxopyrimidin-5-yl)acetic acid?
The InChIKey is JDMMXOUNOVILAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N2O3/c1-5-6-7-8-9-11(2)18-13(4)14(10-15(19)20)12(3)17-16(18)21/h11H,5-10H2,1-4H3,(H,19,20).
What are the key properties of 2-(4,6-dimethyl-1-octan-2-yl-2-oxopyrimidin-5-yl)acetic acid?
2-(4,6-dimethyl-1-octan-2-yl-2-oxopyrimidin-5-yl)acetic acid has a molecular weight of 294.39 g/mol, XLogP of 3.02, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,6-dimethyl-1-octan-2-yl-2-oxopyrimidin-5-yl)acetic acid is sourced from PubChem (CID 61478439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).