C14H25N3O2 — CID 83233445
ethyl 5-methyl-4-octan-2-yl-1,2,4-triazole-3-carboxylate (PubChem CID 83233445) has the molecular formula C14H25N3O2 and a molecular weight of 267.37 g/mol. Its IUPAC name is ethyl 5-methyl-4-octan-2-yl-1,2,4-triazole-3-carboxylate.
| Compound Name | ethyl 5-methyl-4-octan-2-yl-1,2,4-triazole-3-carboxylate |
|---|---|
| PubChem CID | 83233445 |
| Molecular Formula | C14H25N3O2 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.19 |
| IUPAC Name | ethyl 5-methyl-4-octan-2-yl-1,2,4-triazole-3-carboxylate |
| SMILES | CCCCCCC(C)n1c(C)nnc1C(=O)OCC |
| InChI | InChI=1S/C14H25N3O2/c1-5-7-8-9-10-11(3)17-12(4)15-16-13(17)14(18)19-6-2/h11H,5-10H2,1-4H3 |
| InChIKey | MHPHNKVBPQPMSY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|