C16H26N2O3 — CID 79219975
2-(4,6-diethyl-1-hexan-3-yl-2-oxopyrimidin-5-yl)acetic acid (PubChem CID 79219975) has the molecular formula C16H26N2O3 and a molecular weight of 294.39 g/mol. Its IUPAC name is 2-(4,6-diethyl-1-hexan-3-yl-2-oxopyrimidin-5-yl)acetic acid.
| Compound Name | 2-(4,6-diethyl-1-hexan-3-yl-2-oxopyrimidin-5-yl)acetic acid |
|---|---|
| PubChem CID | 79219975 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | 2-(4,6-diethyl-1-hexan-3-yl-2-oxopyrimidin-5-yl)acetic acid |
| SMILES | CCCC(CC)n1c(CC)c(CC(=O)O)c(CC)nc1=O |
| InChI | InChI=1S/C16H26N2O3/c1-5-9-11(6-2)18-14(8-4)12(10-15(19)20)13(7-3)17-16(18)21/h11H,5-10H2,1-4H3,(H,19,20) |
| InChIKey | FNIBKHQRDWJOHF-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |