About 1-nonan-2-ylpyrazole
1-nonan-2-ylpyrazole (PubChem CID 121348533) has the molecular formula C12H22N2
and a molecular weight of 194.32 g/mol. Its IUPAC name is 1-nonan-2-ylpyrazole.
Molecular Properties
| Compound Name | 1-nonan-2-ylpyrazole |
| PubChem CID | 121348533 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | 1-nonan-2-ylpyrazole |
| SMILES | CCCCCCCC(C)n1cccn1 |
| InChI | InChI=1S/C12H22N2/c1-3-4-5-6-7-9-12(2)14-11-8-10-13-14/h8,10-12H,3-7,9H2,1-2H3 |
| InChIKey | HLELNETYQKABES-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-nonan-2-ylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-nonan-2-ylpyrazole?
The IUPAC name of 1-nonan-2-ylpyrazole (CID 121348533) is 1-nonan-2-ylpyrazole.
What is the SMILES notation for 1-nonan-2-ylpyrazole?
The canonical SMILES for 1-nonan-2-ylpyrazole is CCCCCCCC(C)n1cccn1.
What is the InChIKey of 1-nonan-2-ylpyrazole?
The InChIKey is HLELNETYQKABES-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2/c1-3-4-5-6-7-9-12(2)14-11-8-10-13-14/h8,10-12H,3-7,9H2,1-2H3.
What are the key properties of 1-nonan-2-ylpyrazole?
1-nonan-2-ylpyrazole has a molecular weight of 194.32 g/mol, XLogP of 3.80, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-nonan-2-ylpyrazole is sourced from PubChem (CID 121348533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).