About 1-heptan-3-ylpyrazole
1-heptan-3-ylpyrazole (PubChem CID 121348512) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is 1-heptan-3-ylpyrazole.
Molecular Properties
| Compound Name | 1-heptan-3-ylpyrazole |
| PubChem CID | 121348512 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 1-heptan-3-ylpyrazole |
| SMILES | CCCCC(CC)n1cccn1 |
| InChI | InChI=1S/C10H18N2/c1-3-5-7-10(4-2)12-9-6-8-11-12/h6,8-10H,3-5,7H2,1-2H3 |
| InChIKey | RGBHNRZUDPTANU-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-heptan-3-ylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-heptan-3-ylpyrazole?
The IUPAC name of 1-heptan-3-ylpyrazole (CID 121348512) is 1-heptan-3-ylpyrazole.
What is the SMILES notation for 1-heptan-3-ylpyrazole?
The canonical SMILES for 1-heptan-3-ylpyrazole is CCCCC(CC)n1cccn1.
What is the InChIKey of 1-heptan-3-ylpyrazole?
The InChIKey is RGBHNRZUDPTANU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2/c1-3-5-7-10(4-2)12-9-6-8-11-12/h6,8-10H,3-5,7H2,1-2H3.
What are the key properties of 1-heptan-3-ylpyrazole?
1-heptan-3-ylpyrazole has a molecular weight of 166.27 g/mol, XLogP of 3.02, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-heptan-3-ylpyrazole is sourced from PubChem (CID 121348512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).