C12H23N3 — CID 43791834
N-(1-pyrazol-1-ylpropan-2-yl)hexan-2-amine (PubChem CID 43791834) has the molecular formula C12H23N3 and a molecular weight of 209.34 g/mol. Its IUPAC name is N-(1-pyrazol-1-ylpropan-2-yl)hexan-2-amine.
| Compound Name | N-(1-pyrazol-1-ylpropan-2-yl)hexan-2-amine |
|---|---|
| PubChem CID | 43791834 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | N-(1-pyrazol-1-ylpropan-2-yl)hexan-2-amine |
| SMILES | CCCCC(C)NC(C)Cn1cccn1 |
| InChI | InChI=1S/C12H23N3/c1-4-5-7-11(2)14-12(3)10-15-9-6-8-13-15/h6,8-9,11-12,14H,4-5,7,10H2,1-3H3 |
| InChIKey | UFRWULREVNUKKK-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |