C8H14FN3 — CID 80601447
N-(2-fluoroethyl)-1-pyrazol-1-ylpropan-2-amine (PubChem CID 80601447) has the molecular formula C8H14FN3 and a molecular weight of 171.22 g/mol. Its IUPAC name is N-(2-fluoroethyl)-1-pyrazol-1-ylpropan-2-amine.
| Compound Name | N-(2-fluoroethyl)-1-pyrazol-1-ylpropan-2-amine |
|---|---|
| PubChem CID | 80601447 |
| Molecular Formula | C8H14FN3 |
| Molecular Weight | 171.22 g/mol |
| Exact Mass | 171.12 |
| IUPAC Name | N-(2-fluoroethyl)-1-pyrazol-1-ylpropan-2-amine |
| SMILES | CC(Cn1cccn1)NCCF |
| InChI | InChI=1S/C8H14FN3/c1-8(10-5-3-9)7-12-6-2-4-11-12/h2,4,6,8,10H,3,5,7H2,1H3 |
| InChIKey | NPYXBFKIASTIGG-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.22 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |