C10H19N3O2S — CID 95027950
(2R)-N-(3-methylsulfonylpropyl)-1-pyrazol-1-ylpropan-2-amine (PubChem CID 95027950) has the molecular formula C10H19N3O2S and a molecular weight of 245.35 g/mol. Its IUPAC name is (2R)-N-(3-methylsulfonylpropyl)-1-pyrazol-1-ylpropan-2-amine.
| Compound Name | (2R)-N-(3-methylsulfonylpropyl)-1-pyrazol-1-ylpropan-2-amine |
|---|---|
| PubChem CID | 95027950 |
| Molecular Formula | C10H19N3O2S |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | (2R)-N-(3-methylsulfonylpropyl)-1-pyrazol-1-ylpropan-2-amine |
| SMILES | C[C@H](Cn1cccn1)NCCCS(C)(=O)=O |
| InChI | InChI=1S/C10H19N3O2S/c1-10(9-13-7-3-6-12-13)11-5-4-8-16(2,14)15/h3,6-7,10-11H,4-5,8-9H2,1-2H3/t10-/m1/s1 |
| InChIKey | WRQAKHWYEYUQTO-SNVBAGLBSA-N |
| XLogP | 0.30 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|