C15H21N3O2S — CID 95279364
(2R)-N-[3-(benzenesulfonyl)propyl]-1-pyrazol-1-ylpropan-2-amine (PubChem CID 95279364) has the molecular formula C15H21N3O2S and a molecular weight of 307.42 g/mol. Its IUPAC name is (2R)-N-[3-(benzenesulfonyl)propyl]-1-pyrazol-1-ylpropan-2-amine.
| Compound Name | (2R)-N-[3-(benzenesulfonyl)propyl]-1-pyrazol-1-ylpropan-2-amine |
|---|---|
| PubChem CID | 95279364 |
| Molecular Formula | C15H21N3O2S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | (2R)-N-[3-(benzenesulfonyl)propyl]-1-pyrazol-1-ylpropan-2-amine |
| SMILES | C[C@H](Cn1cccn1)NCCCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H21N3O2S/c1-14(13-18-11-5-10-17-18)16-9-6-12-21(19,20)15-7-3-2-4-8-15/h2-5,7-8,10-11,14,16H,6,9,12-13H2,1H3/t14-/m1/s1 |
| InChIKey | LMSKFXMZSUBZKR-CQSZACIVSA-N |
| XLogP | 1.73 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|