C10H18ClN3O2S — CID 116815471
4-chloro-N-(1-pyrazol-1-ylpropan-2-yl)butane-1-sulfonamide (PubChem CID 116815471) has the molecular formula C10H18ClN3O2S and a molecular weight of 279.79 g/mol. Its IUPAC name is 4-chloro-N-(1-pyrazol-1-ylpropan-2-yl)butane-1-sulfonamide.
| Compound Name | 4-chloro-N-(1-pyrazol-1-ylpropan-2-yl)butane-1-sulfonamide |
|---|---|
| PubChem CID | 116815471 |
| Molecular Formula | C10H18ClN3O2S |
| Molecular Weight | 279.79 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 4-chloro-N-(1-pyrazol-1-ylpropan-2-yl)butane-1-sulfonamide |
| SMILES | CC(Cn1cccn1)NS(=O)(=O)CCCCCl |
| InChI | InChI=1S/C10H18ClN3O2S/c1-10(9-14-7-4-6-12-14)13-17(15,16)8-3-2-5-11/h4,6-7,10,13H,2-3,5,8-9H2,1H3 |
| InChIKey | RLEHSUDNAZDFIY-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.79 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|