About 1-butan-2-ylpyrazole;ethane
1-butan-2-ylpyrazole;ethane (PubChem CID 170732307) has the molecular formula C9H18N2
and a molecular weight of 154.26 g/mol. Its IUPAC name is 1-butan-2-ylpyrazole;ethane.
Molecular Properties
| Compound Name | 1-butan-2-ylpyrazole;ethane |
| PubChem CID | 170732307 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | 1-butan-2-ylpyrazole;ethane |
| SMILES | CC.CCC(C)n1cccn1 |
| InChI | InChI=1S/C7H12N2.C2H6/c1-3-7(2)9-6-4-5-8-9;1-2/h4-7H,3H2,1-2H3;1-2H3 |
| InChIKey | LSNQEOYZEXUATJ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-butan-2-ylpyrazole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butan-2-ylpyrazole;ethane?
The IUPAC name of 1-butan-2-ylpyrazole;ethane (CID 170732307) is 1-butan-2-ylpyrazole;ethane.
What is the SMILES notation for 1-butan-2-ylpyrazole;ethane?
The canonical SMILES for 1-butan-2-ylpyrazole;ethane is CC.CCC(C)n1cccn1.
What is the InChIKey of 1-butan-2-ylpyrazole;ethane?
The InChIKey is LSNQEOYZEXUATJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2.C2H6/c1-3-7(2)9-6-4-5-8-9;1-2/h4-7H,3H2,1-2H3;1-2H3.
What are the key properties of 1-butan-2-ylpyrazole;ethane?
1-butan-2-ylpyrazole;ethane has a molecular weight of 154.26 g/mol, XLogP of 2.88, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butan-2-ylpyrazole;ethane is sourced from PubChem (CID 170732307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).