About ethane;2-methylpropane;1-propan-2-ylpyrazole
ethane;2-methylpropane;1-propan-2-ylpyrazole (PubChem CID 158347512) has the molecular formula C12H26N2
and a molecular weight of 198.35 g/mol. Its IUPAC name is ethane;2-methylpropane;1-propan-2-ylpyrazole.
Molecular Properties
| Compound Name | ethane;2-methylpropane;1-propan-2-ylpyrazole |
| PubChem CID | 158347512 |
| Molecular Formula | C12H26N2 |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.21 |
| IUPAC Name | ethane;2-methylpropane;1-propan-2-ylpyrazole |
| SMILES | CC.CC(C)C.CC(C)n1cccn1 |
| InChI | InChI=1S/C6H10N2.C4H10.C2H6/c1-6(2)8-5-3-4-7-8;1-4(2)3;1-2/h3-6H,1-2H3;4H,1-3H3;1-2H3 |
| InChIKey | GRXJKULMTTWXIZ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;2-methylpropane;1-propan-2-ylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methylpropane;1-propan-2-ylpyrazole?
The IUPAC name of ethane;2-methylpropane;1-propan-2-ylpyrazole (CID 158347512) is ethane;2-methylpropane;1-propan-2-ylpyrazole.
What is the SMILES notation for ethane;2-methylpropane;1-propan-2-ylpyrazole?
The canonical SMILES for ethane;2-methylpropane;1-propan-2-ylpyrazole is CC.CC(C)C.CC(C)n1cccn1.
What is the InChIKey of ethane;2-methylpropane;1-propan-2-ylpyrazole?
The InChIKey is GRXJKULMTTWXIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2.C4H10.C2H6/c1-6(2)8-5-3-4-7-8;1-4(2)3;1-2/h3-6H,1-2H3;4H,1-3H3;1-2H3.
What are the key properties of ethane;2-methylpropane;1-propan-2-ylpyrazole?
ethane;2-methylpropane;1-propan-2-ylpyrazole has a molecular weight of 198.35 g/mol, XLogP of 4.15, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methylpropane;1-propan-2-ylpyrazole is sourced from PubChem (CID 158347512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).