About 2-methylpropane;1-propan-2-ylpyrazole
2-methylpropane;1-propan-2-ylpyrazole (PubChem CID 159283951) has the molecular formula C10H20N2
and a molecular weight of 168.28 g/mol. Its IUPAC name is 2-methylpropane;1-propan-2-ylpyrazole.
Molecular Properties
| Compound Name | 2-methylpropane;1-propan-2-ylpyrazole |
| PubChem CID | 159283951 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | 2-methylpropane;1-propan-2-ylpyrazole |
| SMILES | CC(C)C.CC(C)n1cccn1 |
| InChI | InChI=1S/C6H10N2.C4H10/c1-6(2)8-5-3-4-7-8;1-4(2)3/h3-6H,1-2H3;4H,1-3H3 |
| InChIKey | KZGRLACQCZMQLY-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methylpropane;1-propan-2-ylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropane;1-propan-2-ylpyrazole?
The IUPAC name of 2-methylpropane;1-propan-2-ylpyrazole (CID 159283951) is 2-methylpropane;1-propan-2-ylpyrazole.
What is the SMILES notation for 2-methylpropane;1-propan-2-ylpyrazole?
The canonical SMILES for 2-methylpropane;1-propan-2-ylpyrazole is CC(C)C.CC(C)n1cccn1.
What is the InChIKey of 2-methylpropane;1-propan-2-ylpyrazole?
The InChIKey is KZGRLACQCZMQLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2.C4H10/c1-6(2)8-5-3-4-7-8;1-4(2)3/h3-6H,1-2H3;4H,1-3H3.
What are the key properties of 2-methylpropane;1-propan-2-ylpyrazole?
2-methylpropane;1-propan-2-ylpyrazole has a molecular weight of 168.28 g/mol, XLogP of 3.13, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropane;1-propan-2-ylpyrazole is sourced from PubChem (CID 159283951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).