About (2S)-2-[[(2R,3R)-3-pyrazol-1-ylbutan-2-yl]amino]hexanamide
(2S)-2-[[(2R,3R)-3-pyrazol-1-ylbutan-2-yl]amino]hexanamide (PubChem CID 95319251) has the molecular formula C13H24N4O
and a molecular weight of 252.36 g/mol. Its IUPAC name is (2S)-2-[[(2R,3R)-3-pyrazol-1-ylbutan-2-yl]amino]hexanamide.
Molecular Properties
| Compound Name | (2S)-2-[[(2R,3R)-3-pyrazol-1-ylbutan-2-yl]amino]hexanamide |
| PubChem CID | 95319251 |
| Molecular Formula | C13H24N4O |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.20 |
| IUPAC Name | (2S)-2-[[(2R,3R)-3-pyrazol-1-ylbutan-2-yl]amino]hexanamide |
| SMILES | CCCC[C@H](N[C@H](C)[C@@H](C)n1cccn1)C(N)=O |
| InChI | InChI=1S/C13H24N4O/c1-4-5-7-12(13(14)18)16-10(2)11(3)17-9-6-8-15-17/h6,8-12,16H,4-5,7H2,1-3H3,(H2,14,18)/t10-,11-,12+/m1/s1 |
| InChIKey | CKMWRMFYBLTZPM-UTUOFQBUSA-N |
| XLogP | 1.47 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-2-[[(2R,3R)-3-pyrazol-1-ylbutan-2-yl]amino]hexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[[(2R,3R)-3-pyrazol-1-ylbutan-2-yl]amino]hexanamide?
The IUPAC name of (2S)-2-[[(2R,3R)-3-pyrazol-1-ylbutan-2-yl]amino]hexanamide (CID 95319251) is (2S)-2-[[(2R,3R)-3-pyrazol-1-ylbutan-2-yl]amino]hexanamide.
What is the SMILES notation for (2S)-2-[[(2R,3R)-3-pyrazol-1-ylbutan-2-yl]amino]hexanamide?
The canonical SMILES for (2S)-2-[[(2R,3R)-3-pyrazol-1-ylbutan-2-yl]amino]hexanamide is CCCC[C@H](N[C@H](C)[C@@H](C)n1cccn1)C(N)=O.
What is the InChIKey of (2S)-2-[[(2R,3R)-3-pyrazol-1-ylbutan-2-yl]amino]hexanamide?
The InChIKey is CKMWRMFYBLTZPM-UTUOFQBUSA-N. The full InChI is InChI=1S/C13H24N4O/c1-4-5-7-12(13(14)18)16-10(2)11(3)17-9-6-8-15-17/h6,8-12,16H,4-5,7H2,1-3H3,(H2,14,18)/t10-,11-,12+/m1/s1.
What are the key properties of (2S)-2-[[(2R,3R)-3-pyrazol-1-ylbutan-2-yl]amino]hexanamide?
(2S)-2-[[(2R,3R)-3-pyrazol-1-ylbutan-2-yl]amino]hexanamide has a molecular weight of 252.36 g/mol, XLogP of 1.47, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[[(2R,3R)-3-pyrazol-1-ylbutan-2-yl]amino]hexanamide is sourced from PubChem (CID 95319251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).