About butane;3-methyloctane;1,4-xylene
butane;3-methyloctane;1,4-xylene (PubChem CID 144940276) has the molecular formula C21H40
and a molecular weight of 292.55 g/mol. Its IUPAC name is butane;3-methyloctane;1,4-xylene.
Molecular Properties
| Compound Name | butane;3-methyloctane;1,4-xylene |
| PubChem CID | 144940276 |
| Molecular Formula | C21H40 |
| Molecular Weight | 292.55 g/mol |
| Exact Mass | 292.31 |
| IUPAC Name | butane;3-methyloctane;1,4-xylene |
| SMILES | CCCC.CCCCCC(C)CC.Cc1ccc(C)cc1 |
| InChI | InChI=1S/C9H20.C8H10.C4H10/c1-4-6-7-8-9(3)5-2;1-7-3-5-8(2)6-4-7;1-3-4-2/h9H,4-8H2,1-3H3;3-6H,1-2H3;3-4H2,1-2H3 |
| InChIKey | ONKLOVWCIFICAH-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 292.55 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butane;3-methyloctane;1,4-xylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;3-methyloctane;1,4-xylene?
The IUPAC name of butane;3-methyloctane;1,4-xylene (CID 144940276) is butane;3-methyloctane;1,4-xylene.
What is the SMILES notation for butane;3-methyloctane;1,4-xylene?
The canonical SMILES for butane;3-methyloctane;1,4-xylene is CCCC.CCCCCC(C)CC.Cc1ccc(C)cc1.
What is the InChIKey of butane;3-methyloctane;1,4-xylene?
The InChIKey is ONKLOVWCIFICAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20.C8H10.C4H10/c1-4-6-7-8-9(3)5-2;1-7-3-5-8(2)6-4-7;1-3-4-2/h9H,4-8H2,1-3H3;3-6H,1-2H3;3-4H2,1-2H3.
What are the key properties of butane;3-methyloctane;1,4-xylene?
butane;3-methyloctane;1,4-xylene has a molecular weight of 292.55 g/mol, XLogP of 7.72, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for butane;3-methyloctane;1,4-xylene is sourced from PubChem (CID 144940276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).