C18H32N2 — CID 63464666
1-heptan-2-yl-2,6,6-trimethyl-5,7-dihydro-4H-indol-4-amine (PubChem CID 63464666) has the molecular formula C18H32N2 and a molecular weight of 276.47 g/mol. Its IUPAC name is 1-heptan-2-yl-2,6,6-trimethyl-5,7-dihydro-4H-indol-4-amine.
| Compound Name | 1-heptan-2-yl-2,6,6-trimethyl-5,7-dihydro-4H-indol-4-amine |
|---|---|
| PubChem CID | 63464666 |
| Molecular Formula | C18H32N2 |
| Molecular Weight | 276.47 g/mol |
| Exact Mass | 276.26 |
| IUPAC Name | 1-heptan-2-yl-2,6,6-trimethyl-5,7-dihydro-4H-indol-4-amine |
| SMILES | CCCCCC(C)n1c(C)cc2c1CC(C)(C)CC2N |
| InChI | InChI=1S/C18H32N2/c1-6-7-8-9-13(2)20-14(3)10-15-16(19)11-18(4,5)12-17(15)20/h10,13,16H,6-9,11-12,19H2,1-5H3 |
| InChIKey | LHWCAGQPLJYCTG-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.47 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|