C16H24N2S — CID 106432346
2,6,6-trimethyl-1-(2-prop-2-ynylsulfanylethyl)-5,7-dihydro-4H-indol-4-amine (PubChem CID 106432346) has the molecular formula C16H24N2S and a molecular weight of 276.45 g/mol. Its IUPAC name is 2,6,6-trimethyl-1-(2-prop-2-ynylsulfanylethyl)-5,7-dihydro-4H-indol-4-amine.
| Compound Name | 2,6,6-trimethyl-1-(2-prop-2-ynylsulfanylethyl)-5,7-dihydro-4H-indol-4-amine |
|---|---|
| PubChem CID | 106432346 |
| Molecular Formula | C16H24N2S |
| Molecular Weight | 276.45 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 2,6,6-trimethyl-1-(2-prop-2-ynylsulfanylethyl)-5,7-dihydro-4H-indol-4-amine |
| SMILES | C#CCSCCn1c(C)cc2c1CC(C)(C)CC2N |
| InChI | InChI=1S/C16H24N2S/c1-5-7-19-8-6-18-12(2)9-13-14(17)10-16(3,4)11-15(13)18/h1,9,14H,6-8,10-11,17H2,2-4H3 |
| InChIKey | CLNYLUFPWHRMLE-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.45 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|