C11H18N2O — CID 42930410
N-butan-2-yl-1,5-dimethylpyrrole-2-carboxamide (PubChem CID 42930410) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is N-butan-2-yl-1,5-dimethylpyrrole-2-carboxamide.
| Compound Name | N-butan-2-yl-1,5-dimethylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 42930410 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | N-butan-2-yl-1,5-dimethylpyrrole-2-carboxamide |
| SMILES | CCC(C)NC(=O)c1ccc(C)n1C |
| InChI | InChI=1S/C11H18N2O/c1-5-8(2)12-11(14)10-7-6-9(3)13(10)4/h6-8H,5H2,1-4H3,(H,12,14) |
| InChIKey | JDPODNNCUAUMOZ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |