C20H19FN2O — CID 112816610
N-[(4-fluorophenyl)-phenylmethyl]-1,5-dimethylpyrrole-2-carboxamide (PubChem CID 112816610) has the molecular formula C20H19FN2O and a molecular weight of 322.38 g/mol. Its IUPAC name is N-[(4-fluorophenyl)-phenylmethyl]-1,5-dimethylpyrrole-2-carboxamide.
| Compound Name | N-[(4-fluorophenyl)-phenylmethyl]-1,5-dimethylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 112816610 |
| Molecular Formula | C20H19FN2O |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | N-[(4-fluorophenyl)-phenylmethyl]-1,5-dimethylpyrrole-2-carboxamide |
| SMILES | Cc1ccc(C(=O)NC(c2ccccc2)c2ccc(F)cc2)n1C |
| InChI | InChI=1S/C20H19FN2O/c1-14-8-13-18(23(14)2)20(24)22-19(15-6-4-3-5-7-15)16-9-11-17(21)12-10-16/h3-13,19H,1-2H3,(H,22,24) |
| InChIKey | OOIKCQUGJLNMOT-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |