C15H12FNO3 — CID 99784106
2-[[(S)-(4-fluorophenyl)-phenylmethyl]amino]-2-oxoacetic acid (PubChem CID 99784106) has the molecular formula C15H12FNO3 and a molecular weight of 273.26 g/mol. Its IUPAC name is 2-[[(S)-(4-fluorophenyl)-phenylmethyl]amino]-2-oxoacetic acid.
| Compound Name | 2-[[(S)-(4-fluorophenyl)-phenylmethyl]amino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 99784106 |
| Molecular Formula | C15H12FNO3 |
| Molecular Weight | 273.26 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 2-[[(S)-(4-fluorophenyl)-phenylmethyl]amino]-2-oxoacetic acid |
| SMILES | O=C(O)C(=O)N[C@@H](c1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H12FNO3/c16-12-8-6-11(7-9-12)13(17-14(18)15(19)20)10-4-2-1-3-5-10/h1-9,13H,(H,17,18)(H,19,20)/t13-/m0/s1 |
| InChIKey | MXGFBVNOMPGCJZ-ZDUSSCGKSA-N |
| XLogP | 2.12 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.26 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|