C25H25FN2O5 — CID 42913580
2-(benzhydrylamino)-N-[1-(4-fluorophenyl)ethyl]acetamide;oxalic acid (PubChem CID 42913580) has the molecular formula C25H25FN2O5 and a molecular weight of 452.48 g/mol. Its IUPAC name is 2-(benzhydrylamino)-N-[1-(4-fluorophenyl)ethyl]acetamide;oxalic acid.
| Compound Name | 2-(benzhydrylamino)-N-[1-(4-fluorophenyl)ethyl]acetamide;oxalic acid |
|---|---|
| PubChem CID | 42913580 |
| Molecular Formula | C25H25FN2O5 |
| Molecular Weight | 452.48 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | 2-(benzhydrylamino)-N-[1-(4-fluorophenyl)ethyl]acetamide;oxalic acid |
| SMILES | CC(NC(=O)CNC(c1ccccc1)c1ccccc1)c1ccc(F)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C23H23FN2O.C2H2O4/c1-17(18-12-14-21(24)15-13-18)26-22(27)16-25-23(19-8-4-2-5-9-19)20-10-6-3-7-11-20;3-1(4)2(5)6/h2-15,17,23,25H,16H2,1H3,(H,26,27);(H,3,4)(H,5,6) |
| InChIKey | RQNRKQYUFSSCDU-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.48 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|