C11H19N3O — CID 63732838
N-(2-aminobutyl)-1,5-dimethylpyrrole-2-carboxamide (PubChem CID 63732838) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is N-(2-aminobutyl)-1,5-dimethylpyrrole-2-carboxamide.
| Compound Name | N-(2-aminobutyl)-1,5-dimethylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 63732838 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | N-(2-aminobutyl)-1,5-dimethylpyrrole-2-carboxamide |
| SMILES | CCC(N)CNC(=O)c1ccc(C)n1C |
| InChI | InChI=1S/C11H19N3O/c1-4-9(12)7-13-11(15)10-6-5-8(2)14(10)3/h5-6,9H,4,7,12H2,1-3H3,(H,13,15) |
| InChIKey | BIUUVEIKDQGXKS-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |