C12H21N3O2 — CID 82994248
N-[2-(2-methoxyethylamino)ethyl]-1,5-dimethylpyrrole-2-carboxamide (PubChem CID 82994248) has the molecular formula C12H21N3O2 and a molecular weight of 239.32 g/mol. Its IUPAC name is N-[2-(2-methoxyethylamino)ethyl]-1,5-dimethylpyrrole-2-carboxamide.
| Compound Name | N-[2-(2-methoxyethylamino)ethyl]-1,5-dimethylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 82994248 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | N-[2-(2-methoxyethylamino)ethyl]-1,5-dimethylpyrrole-2-carboxamide |
| SMILES | COCCNCCNC(=O)c1ccc(C)n1C |
| InChI | InChI=1S/C12H21N3O2/c1-10-4-5-11(15(10)2)12(16)14-7-6-13-8-9-17-3/h4-5,13H,6-9H2,1-3H3,(H,14,16) |
| InChIKey | HJCUCNGXCHHARN-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|