C12H20N2O2 — CID 107318560
N-(5-hydroxypentyl)-1,5-dimethylpyrrole-2-carboxamide (PubChem CID 107318560) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is N-(5-hydroxypentyl)-1,5-dimethylpyrrole-2-carboxamide.
| Compound Name | N-(5-hydroxypentyl)-1,5-dimethylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 107318560 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | N-(5-hydroxypentyl)-1,5-dimethylpyrrole-2-carboxamide |
| SMILES | Cc1ccc(C(=O)NCCCCCO)n1C |
| InChI | InChI=1S/C12H20N2O2/c1-10-6-7-11(14(10)2)12(16)13-8-4-3-5-9-15/h6-7,15H,3-5,8-9H2,1-2H3,(H,13,16) |
| InChIKey | ZIZICMWFUVBHEQ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|