C10H21F4NO3S — CID 86660801
1,1,2,2-tetrafluoro-4-hydroxybutane-1-sulfinate;triethylazanium (PubChem CID 86660801) has the molecular formula C10H21F4NO3S and a molecular weight of 311.34 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-4-hydroxybutane-1-sulfinate;triethylazanium.
| Compound Name | 1,1,2,2-tetrafluoro-4-hydroxybutane-1-sulfinate;triethylazanium |
|---|---|
| PubChem CID | 86660801 |
| Molecular Formula | C10H21F4NO3S |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 1,1,2,2-tetrafluoro-4-hydroxybutane-1-sulfinate;triethylazanium |
| SMILES | CC[NH+](CC)CC.O=S([O-])C(F)(F)C(F)(F)CCO |
| InChI | InChI=1S/C6H15N.C4H6F4O3S/c1-4-7(5-2)6-3;5-3(6,1-2-9)4(7,8)12(10)11/h4-6H2,1-3H3;9H,1-2H2,(H,10,11) |
| InChIKey | NURARYXRRMRHAX-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 64.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|