C2HF5KO2S- — CID 174997119
potassium;hydride;1,1,2,2,2-pentafluoroethanesulfinate (PubChem CID 174997119) has the molecular formula C2HF5KO2S- and a molecular weight of 223.18 g/mol. Its IUPAC name is potassium;hydride;1,1,2,2,2-pentafluoroethanesulfinate.
| Compound Name | potassium;hydride;1,1,2,2,2-pentafluoroethanesulfinate |
|---|---|
| PubChem CID | 174997119 |
| Molecular Formula | C2HF5KO2S- |
| Molecular Weight | 223.18 g/mol |
| Exact Mass | 222.93 |
| IUPAC Name | potassium;hydride;1,1,2,2,2-pentafluoroethanesulfinate |
| SMILES | O=S([O-])C(F)(F)C(F)(F)F.[H-].[K+] |
| InChI | InChI=1S/C2HF5O2S.K.H/c3-1(4,5)2(6,7)10(8)9;;/h(H,8,9);;/q;+1;-1/p-1 |
| InChIKey | ZVQNBGABXPZSPF-UHFFFAOYSA-M |
| XLogP | -1.86 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.18 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|