C3H2F5O2S- — CID 23206815
2,2,3,3,3-pentafluoropropane-1-sulfinate (PubChem CID 23206815) has the molecular formula C3H2F5O2S- and a molecular weight of 197.10 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoropropane-1-sulfinate.
| Compound Name | 2,2,3,3,3-pentafluoropropane-1-sulfinate |
|---|---|
| PubChem CID | 23206815 |
| Molecular Formula | C3H2F5O2S- |
| Molecular Weight | 197.10 g/mol |
| Exact Mass | 196.97 |
| IUPAC Name | 2,2,3,3,3-pentafluoropropane-1-sulfinate |
| SMILES | O=S([O-])CC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C3H3F5O2S/c4-2(5,1-11(9)10)3(6,7)8/h1H2,(H,9,10)/p-1 |
| InChIKey | HPCXYPQDSRIXOA-UHFFFAOYSA-M |
| XLogP | 1.06 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.10 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|