C12H11F14O2S- — CID 162540797
6,7,7,7-tetrafluoro-4-[2,3,3,3-tetrafluoro-2-(trifluoromethyl)propyl]-6-(trifluoromethyl)heptane-1-sulfinate (PubChem CID 162540797) has the molecular formula C12H11F14O2S- and a molecular weight of 485.26 g/mol. Its IUPAC name is 6,7,7,7-tetrafluoro-4-[2,3,3,3-tetrafluoro-2-(trifluoromethyl)propyl]-6-(trifluoromethyl)heptane-1-sulfinate.
| Compound Name | 6,7,7,7-tetrafluoro-4-[2,3,3,3-tetrafluoro-2-(trifluoromethyl)propyl]-6-(trifluoromethyl)heptane-1-sulfinate |
|---|---|
| PubChem CID | 162540797 |
| Molecular Formula | C12H11F14O2S- |
| Molecular Weight | 485.26 g/mol |
| Exact Mass | 485.03 |
| IUPAC Name | 6,7,7,7-tetrafluoro-4-[2,3,3,3-tetrafluoro-2-(trifluoromethyl)propyl]-6-(trifluoromethyl)heptane-1-sulfinate |
| SMILES | O=S([O-])CCCC(CC(F)(C(F)(F)F)C(F)(F)F)CC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H12F14O2S/c13-7(9(15,16)17,10(18,19)20)4-6(2-1-3-29(27)28)5-8(14,11(21,22)23)12(24,25)26/h6H,1-5H2,(H,27,28)/p-1 |
| InChIKey | MTAYVHUBZBBJDA-UHFFFAOYSA-M |
| XLogP | 5.71 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.26 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|