C4H7ClO4S2-2 — CID 175047226
1-chlorobutane-1,4-disulfinate (PubChem CID 175047226) has the molecular formula C4H7ClO4S2-2 and a molecular weight of 218.68 g/mol. Its IUPAC name is 1-chlorobutane-1,4-disulfinate.
| Compound Name | 1-chlorobutane-1,4-disulfinate |
|---|---|
| PubChem CID | 175047226 |
| Molecular Formula | C4H7ClO4S2-2 |
| Molecular Weight | 218.68 g/mol |
| Exact Mass | 217.95 |
| IUPAC Name | 1-chlorobutane-1,4-disulfinate |
| SMILES | O=S([O-])CCCC(Cl)S(=O)[O-] |
| InChI | InChI=1S/C4H9ClO4S2/c5-4(11(8)9)2-1-3-10(6)7/h4H,1-3H2,(H,6,7)(H,8,9)/p-2 |
| InChIKey | FHDJNJDWJZIVRR-UHFFFAOYSA-L |
| XLogP | 0.09 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.68 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|