C16H19F15S — CID 87159374
1,1,1,2,9,10,10,10-octafluoro-4-[3-(fluoromethylsulfanyl)propyl]-2,9-bis(trifluoromethyl)decane (PubChem CID 87159374) has the molecular formula C16H19F15S and a molecular weight of 528.37 g/mol. Its IUPAC name is 1,1,1,2,9,10,10,10-octafluoro-4-[3-(fluoromethylsulfanyl)propyl]-2,9-bis(trifluoromethyl)decane.
| Compound Name | 1,1,1,2,9,10,10,10-octafluoro-4-[3-(fluoromethylsulfanyl)propyl]-2,9-bis(trifluoromethyl)decane |
|---|---|
| PubChem CID | 87159374 |
| Molecular Formula | C16H19F15S |
| Molecular Weight | 528.37 g/mol |
| Exact Mass | 528.10 |
| IUPAC Name | 1,1,1,2,9,10,10,10-octafluoro-4-[3-(fluoromethylsulfanyl)propyl]-2,9-bis(trifluoromethyl)decane |
| SMILES | FCSCCCC(CCCCC(F)(C(F)(F)F)C(F)(F)F)CC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H19F15S/c17-9-32-7-3-5-10(8-12(19,15(26,27)28)16(29,30)31)4-1-2-6-11(18,13(20,21)22)14(23,24)25/h10H,1-9H2 |
| InChIKey | XNUJVAXRRDIPLZ-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.37 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|