C9H10F9O3S- — CID 134167024
2,2-difluoro-3-(2,3,3,4,4,5,5-heptafluorohexan-2-yloxy)propane-1-sulfinate (PubChem CID 134167024) has the molecular formula C9H10F9O3S- and a molecular weight of 369.23 g/mol. Its IUPAC name is 2,2-difluoro-3-(2,3,3,4,4,5,5-heptafluorohexan-2-yloxy)propane-1-sulfinate.
| Compound Name | 2,2-difluoro-3-(2,3,3,4,4,5,5-heptafluorohexan-2-yloxy)propane-1-sulfinate |
|---|---|
| PubChem CID | 134167024 |
| Molecular Formula | C9H10F9O3S- |
| Molecular Weight | 369.23 g/mol |
| Exact Mass | 369.02 |
| IUPAC Name | 2,2-difluoro-3-(2,3,3,4,4,5,5-heptafluorohexan-2-yloxy)propane-1-sulfinate |
| SMILES | CC(F)(F)C(F)(F)C(F)(F)C(C)(F)OCC(F)(F)CS(=O)[O-] |
| InChI | InChI=1S/C9H11F9O3S/c1-5(10,11)8(15,16)9(17,18)6(2,12)21-3-7(13,14)4-22(19)20/h3-4H2,1-2H3,(H,19,20)/p-1 |
| InChIKey | KKEHHANXYMNLJW-UHFFFAOYSA-M |
| XLogP | 3.13 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.23 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|