C6H8F6O — CID 152519204
1-ethoxy-1,1,2,2,3,3-hexafluorobutane (PubChem CID 152519204) has the molecular formula C6H8F6O and a molecular weight of 210.12 g/mol. Its IUPAC name is 1-ethoxy-1,1,2,2,3,3-hexafluorobutane.
| Compound Name | 1-ethoxy-1,1,2,2,3,3-hexafluorobutane |
|---|---|
| PubChem CID | 152519204 |
| Molecular Formula | C6H8F6O |
| Molecular Weight | 210.12 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | 1-ethoxy-1,1,2,2,3,3-hexafluorobutane |
| SMILES | CCOC(F)(F)C(F)(F)C(C)(F)F |
| InChI | InChI=1S/C6H8F6O/c1-3-13-6(11,12)5(9,10)4(2,7)8/h3H2,1-2H3 |
| InChIKey | YHECTMAPSBUYQZ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.12 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|