C8H5F13O — CID 87277022
1-ethoxy-1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane (PubChem CID 87277022) has the molecular formula C8H5F13O and a molecular weight of 364.10 g/mol. Its IUPAC name is 1-ethoxy-1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane.
| Compound Name | 1-ethoxy-1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane |
|---|---|
| PubChem CID | 87277022 |
| Molecular Formula | C8H5F13O |
| Molecular Weight | 364.10 g/mol |
| Exact Mass | 364.01 |
| IUPAC Name | 1-ethoxy-1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane |
| SMILES | CCOC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H5F13O/c1-2-22-8(20,21)6(15,16)4(11,12)3(9,10)5(13,14)7(17,18)19/h2H2,1H3 |
| InChIKey | KKOZACSVPTWBIT-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.10 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|